C19H21ClN4O — CID 44513221
(Z)-1-[5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]-N-(4-chlorophenoxy)ethanimine (PubChem CID 44513221) has the molecular formula C19H21ClN4O and a molecular weight of 356.86 g/mol. Its IUPAC name is (Z)-1-[5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]-N-(4-chlorophenoxy)ethanimine.
| Compound Name | (Z)-1-[5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]-N-(4-chlorophenoxy)ethanimine |
|---|---|
| PubChem CID | 44513221 |
| Molecular Formula | C19H21ClN4O |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (Z)-1-[5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]-N-(4-chlorophenoxy)ethanimine |
| SMILES | C/C(=N/Oc1ccc(Cl)cc1)c1cncc(N2C[C@H]3CNC[C@H]3C2)c1 |
| InChI | InChI=1S/C19H21ClN4O/c1-13(23-25-19-4-2-17(20)3-5-19)14-6-18(10-22-7-14)24-11-15-8-21-9-16(15)12-24/h2-7,10,15-16,21H,8-9,11-12H2,1H3/b23-13-/t15-,16+ |
| InChIKey | LKAOIMRKBFZGMD-PZFMYRMPSA-N |
| XLogP | 3.19 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|