C33H31N3O4 — CID 44518260
2-[(2R,3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-5-yl]-1H-imidazo[4,5-b]pyridine (PubChem CID 44518260) has the molecular formula C33H31N3O4 and a molecular weight of 533.63 g/mol. Its IUPAC name is 2-[(2R,3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-5-yl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[(2R,3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-5-yl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 44518260 |
| Molecular Formula | C33H31N3O4 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 2-[(2R,3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-5-yl]-1H-imidazo[4,5-b]pyridine |
| SMILES | C1=C(c2nc3ncccc3[nH]2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C33H31N3O4/c1-4-11-24(12-5-1)19-37-23-29-31(40-21-26-15-8-3-9-16-26)30(39-20-25-13-6-2-7-14-25)27(22-38-29)32-35-28-17-10-18-34-33(28)36-32/h1-18,22,29-31H,19-21,23H2,(H,34,35,36)/t29-,30-,31-/m1/s1 |
| InChIKey | LWHFBHGXOCQTOM-JFHPUIQFSA-N |
| XLogP | 6.09 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |