C23H18Cl2F5N7O3S — CID 44520018
N-[4-[3,5-dichloro-4-(3,3,4,4,4-pentafluorobutoxy)phenyl]-1,3-thiazol-2-yl]-2-(5-methyl-4-oxo-7,8-dihydroimidazo[2,1-b]purin-3-yl)acetamide (PubChem CID 44520018) has the molecular formula C23H18Cl2F5N7O3S and a molecular weight of 638.41 g/mol. Its IUPAC name is N-[4-[3,5-dichloro-4-(3,3,4,4,4-pentafluorobutoxy)phenyl]-1,3-thiazol-2-yl]-2-(5-methyl-4-oxo-7,8-dihydroimidazo[2,1-b]purin-3-yl)acetamide.
| Compound Name | N-[4-[3,5-dichloro-4-(3,3,4,4,4-pentafluorobutoxy)phenyl]-1,3-thiazol-2-yl]-2-(5-methyl-4-oxo-7,8-dihydroimidazo[2,1-b]purin-3-yl)acetamide |
|---|---|
| PubChem CID | 44520018 |
| Molecular Formula | C23H18Cl2F5N7O3S |
| Molecular Weight | 638.41 g/mol |
| Exact Mass | 637.05 |
| IUPAC Name | N-[4-[3,5-dichloro-4-(3,3,4,4,4-pentafluorobutoxy)phenyl]-1,3-thiazol-2-yl]-2-(5-methyl-4-oxo-7,8-dihydroimidazo[2,1-b]purin-3-yl)acetamide |
| SMILES | CN1C(=O)c2c(ncn2CC(=O)Nc2nc(-c3cc(Cl)c(OCCC(F)(F)C(F)(F)F)c(Cl)c3)cs2)N2CCN=C12 |
| InChI | InChI=1S/C23H18Cl2F5N7O3S/c1-35-19(39)16-18(37-4-3-31-21(35)37)32-10-36(16)8-15(38)34-20-33-14(9-41-20)11-6-12(24)17(13(25)7-11)40-5-2-22(26,27)23(28,29)30/h6-7,9-10H,2-5,8H2,1H3,(H,33,34,38) |
| InChIKey | SQXCCDLHFDXQEU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|