C23H18N4OS2 — CID 44525388
1-[3-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]-3-thiophen-3-ylurea (PubChem CID 44525388) has the molecular formula C23H18N4OS2 and a molecular weight of 430.56 g/mol. Its IUPAC name is 1-[3-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]-3-thiophen-3-ylurea.
| Compound Name | 1-[3-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]-3-thiophen-3-ylurea |
|---|---|
| PubChem CID | 44525388 |
| Molecular Formula | C23H18N4OS2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 1-[3-[5-(4-methyl-1H-benzimidazol-2-yl)thiophen-2-yl]phenyl]-3-thiophen-3-ylurea |
| SMILES | Cc1cccc2[nH]c(-c3ccc(-c4cccc(NC(=O)Nc5ccsc5)c4)s3)nc12 |
| InChI | InChI=1S/C23H18N4OS2/c1-14-4-2-7-18-21(14)27-22(26-18)20-9-8-19(30-20)15-5-3-6-16(12-15)24-23(28)25-17-10-11-29-13-17/h2-13H,1H3,(H,26,27)(H2,24,25,28) |
| InChIKey | VGEVKDOUPOBCKX-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |