C28H33F3N2O — CID 44525811
(E)-N-[4-[4-(2-methylphenyl)piperidin-1-yl]cyclohexyl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 44525811) has the molecular formula C28H33F3N2O and a molecular weight of 470.58 g/mol. Its IUPAC name is (E)-N-[4-[4-(2-methylphenyl)piperidin-1-yl]cyclohexyl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-[4-(2-methylphenyl)piperidin-1-yl]cyclohexyl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 44525811 |
| Molecular Formula | C28H33F3N2O |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | (E)-N-[4-[4-(2-methylphenyl)piperidin-1-yl]cyclohexyl]-3-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccccc1C1CCN(C2CCC(NC(=O)/C=C/c3ccccc3C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C28H33F3N2O/c1-20-6-2-4-8-25(20)21-16-18-33(19-17-21)24-13-11-23(12-14-24)32-27(34)15-10-22-7-3-5-9-26(22)28(29,30)31/h2-10,15,21,23-24H,11-14,16-19H2,1H3,(H,32,34)/b15-10+ |
| InChIKey | RXNLDPZTFDBGGJ-XNTDXEJSSA-N |
| XLogP | 6.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|