C26H25Cl2N5O2 — CID 44525869
5-[(3,5-dichlorophenyl)methoxy]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-benzimidazole-4-carboxamide (PubChem CID 44525869) has the molecular formula C26H25Cl2N5O2 and a molecular weight of 510.43 g/mol. Its IUPAC name is 5-[(3,5-dichlorophenyl)methoxy]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 5-[(3,5-dichlorophenyl)methoxy]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 44525869 |
| Molecular Formula | C26H25Cl2N5O2 |
| Molecular Weight | 510.43 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 5-[(3,5-dichlorophenyl)methoxy]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-benzimidazole-4-carboxamide |
| SMILES | CN1CCN(c2ccc(-c3nc4c(C(N)=O)c(OCc5cc(Cl)cc(Cl)c5)ccc4[nH]3)cc2)CC1 |
| InChI | InChI=1S/C26H25Cl2N5O2/c1-32-8-10-33(11-9-32)20-4-2-17(3-5-20)26-30-21-6-7-22(23(25(29)34)24(21)31-26)35-15-16-12-18(27)14-19(28)13-16/h2-7,12-14H,8-11,15H2,1H3,(H2,29,34)(H,30,31) |
| InChIKey | ATABGJWFEBPWOR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|