C27H28F3N3O3S — CID 44526052
3-[(1-benzylpiperidin-3-yl)methylsulfamoyl]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 44526052) has the molecular formula C27H28F3N3O3S and a molecular weight of 531.60 g/mol. Its IUPAC name is 3-[(1-benzylpiperidin-3-yl)methylsulfamoyl]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[(1-benzylpiperidin-3-yl)methylsulfamoyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 44526052 |
| Molecular Formula | C27H28F3N3O3S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 3-[(1-benzylpiperidin-3-yl)methylsulfamoyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1cccc(S(=O)(=O)NCC2CCCN(Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C27H28F3N3O3S/c28-27(29,30)23-11-5-12-24(16-23)32-26(34)22-10-4-13-25(15-22)37(35,36)31-17-21-9-6-14-33(19-21)18-20-7-2-1-3-8-20/h1-5,7-8,10-13,15-16,21,31H,6,9,14,17-19H2,(H,32,34) |
| InChIKey | OVOQKPVGHPMAAO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |