C27H31FN2OS — CID 44527321
4-(2-fluorophenyl)-N-[1-[(4-propan-2-ylphenyl)methyl]azepan-3-yl]thiophene-2-carboxamide (PubChem CID 44527321) has the molecular formula C27H31FN2OS and a molecular weight of 450.62 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N-[1-[(4-propan-2-ylphenyl)methyl]azepan-3-yl]thiophene-2-carboxamide.
| Compound Name | 4-(2-fluorophenyl)-N-[1-[(4-propan-2-ylphenyl)methyl]azepan-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 44527321 |
| Molecular Formula | C27H31FN2OS |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 4-(2-fluorophenyl)-N-[1-[(4-propan-2-ylphenyl)methyl]azepan-3-yl]thiophene-2-carboxamide |
| SMILES | CC(C)c1ccc(CN2CCCCC(NC(=O)c3cc(-c4ccccc4F)cs3)C2)cc1 |
| InChI | InChI=1S/C27H31FN2OS/c1-19(2)21-12-10-20(11-13-21)16-30-14-6-5-7-23(17-30)29-27(31)26-15-22(18-32-26)24-8-3-4-9-25(24)28/h3-4,8-13,15,18-19,23H,5-7,14,16-17H2,1-2H3,(H,29,31) |
| InChIKey | ORISIPVHXVWGBO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |