C20H26ClNO — CID 44531466
4-benzyl-2-[(cyclohexylamino)methyl]phenol;hydrochloride (PubChem CID 44531466) has the molecular formula C20H26ClNO and a molecular weight of 331.89 g/mol. Its IUPAC name is 4-benzyl-2-[(cyclohexylamino)methyl]phenol;hydrochloride.
| Compound Name | 4-benzyl-2-[(cyclohexylamino)methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 44531466 |
| Molecular Formula | C20H26ClNO |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 4-benzyl-2-[(cyclohexylamino)methyl]phenol;hydrochloride |
| SMILES | Cl.Oc1ccc(Cc2ccccc2)cc1CNC1CCCCC1 |
| InChI | InChI=1S/C20H25NO.ClH/c22-20-12-11-17(13-16-7-3-1-4-8-16)14-18(20)15-21-19-9-5-2-6-10-19;/h1,3-4,7-8,11-12,14,19,21-22H,2,5-6,9-10,13,15H2;1H |
| InChIKey | VISHXLJIWGEYOC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|