C28H28ClFN4O — CID 44532468
N-(2-chloro-4-fluorophenyl)-7-[3-[(2-morpholin-4-ylethylamino)methyl]phenyl]quinolin-4-amine (PubChem CID 44532468) has the molecular formula C28H28ClFN4O and a molecular weight of 491.01 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-7-[3-[(2-morpholin-4-ylethylamino)methyl]phenyl]quinolin-4-amine.
| Compound Name | N-(2-chloro-4-fluorophenyl)-7-[3-[(2-morpholin-4-ylethylamino)methyl]phenyl]quinolin-4-amine |
|---|---|
| PubChem CID | 44532468 |
| Molecular Formula | C28H28ClFN4O |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-7-[3-[(2-morpholin-4-ylethylamino)methyl]phenyl]quinolin-4-amine |
| SMILES | Fc1ccc(Nc2ccnc3cc(-c4cccc(CNCCN5CCOCC5)c4)ccc23)c(Cl)c1 |
| InChI | InChI=1S/C28H28ClFN4O/c29-25-18-23(30)5-7-27(25)33-26-8-9-32-28-17-22(4-6-24(26)28)21-3-1-2-20(16-21)19-31-10-11-34-12-14-35-15-13-34/h1-9,16-18,31H,10-15,19H2,(H,32,33) |
| InChIKey | CMECLDURCGCBMY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|