C27H26Cl2N4 — CID 25003794
7-chloro-N-[(4-chlorophenyl)-[4-(piperazin-1-ylmethyl)phenyl]methyl]quinolin-4-amine (PubChem CID 25003794) has the molecular formula C27H26Cl2N4 and a molecular weight of 477.44 g/mol. Its IUPAC name is 7-chloro-N-[(4-chlorophenyl)-[4-(piperazin-1-ylmethyl)phenyl]methyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[(4-chlorophenyl)-[4-(piperazin-1-ylmethyl)phenyl]methyl]quinolin-4-amine |
|---|---|
| PubChem CID | 25003794 |
| Molecular Formula | C27H26Cl2N4 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 7-chloro-N-[(4-chlorophenyl)-[4-(piperazin-1-ylmethyl)phenyl]methyl]quinolin-4-amine |
| SMILES | Clc1ccc(C(Nc2ccnc3cc(Cl)ccc23)c2ccc(CN3CCNCC3)cc2)cc1 |
| InChI | InChI=1S/C27H26Cl2N4/c28-22-7-5-21(6-8-22)27(32-25-11-12-31-26-17-23(29)9-10-24(25)26)20-3-1-19(2-4-20)18-33-15-13-30-14-16-33/h1-12,17,27,30H,13-16,18H2,(H,31,32) |
| InChIKey | DWRXOPFOPGXZKZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |