C18H18Cl2N6O — CID 44532869
1-[4-[(2-aminopyrimidin-4-yl)-methylamino]phenyl]-3-(3-chlorophenyl)urea;hydrochloride (PubChem CID 44532869) has the molecular formula C18H18Cl2N6O and a molecular weight of 405.29 g/mol. Its IUPAC name is 1-[4-[(2-aminopyrimidin-4-yl)-methylamino]phenyl]-3-(3-chlorophenyl)urea;hydrochloride.
| Compound Name | 1-[4-[(2-aminopyrimidin-4-yl)-methylamino]phenyl]-3-(3-chlorophenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 44532869 |
| Molecular Formula | C18H18Cl2N6O |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-[4-[(2-aminopyrimidin-4-yl)-methylamino]phenyl]-3-(3-chlorophenyl)urea;hydrochloride |
| SMILES | CN(c1ccc(NC(=O)Nc2cccc(Cl)c2)cc1)c1ccnc(N)n1.Cl |
| InChI | InChI=1S/C18H17ClN6O.ClH/c1-25(16-9-10-21-17(20)24-16)15-7-5-13(6-8-15)22-18(26)23-14-4-2-3-12(19)11-14;/h2-11H,1H3,(H2,20,21,24)(H2,22,23,26);1H |
| InChIKey | UBAJHLYNLKELGL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |