C29H29Cl2N5 — CID 44533499
4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-N-methylaniline (PubChem CID 44533499) has the molecular formula C29H29Cl2N5 and a molecular weight of 518.49 g/mol. Its IUPAC name is 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-N-methylaniline.
| Compound Name | 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-N-methylaniline |
|---|---|
| PubChem CID | 44533499 |
| Molecular Formula | C29H29Cl2N5 |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 4-(5,6-dichloro-1H-benzimidazol-2-yl)-N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]-N-methylaniline |
| SMILES | CN(CCN1CCC(c2c[nH]c3ccccc23)CC1)c1ccc(-c2nc3cc(Cl)c(Cl)cc3[nH]2)cc1 |
| InChI | InChI=1S/C29H29Cl2N5/c1-35(14-15-36-12-10-19(11-13-36)23-18-32-26-5-3-2-4-22(23)26)21-8-6-20(7-9-21)29-33-27-16-24(30)25(31)17-28(27)34-29/h2-9,16-19,32H,10-15H2,1H3,(H,33,34) |
| InChIKey | XTYRTCRYHKIEPI-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|