C23H23Cl2N3O2 — CID 44533536
(E)-3-(3,4-dichlorophenyl)-N-[2,2-dimethyl-3-[(4-oxo-1H-quinolin-2-yl)amino]propyl]prop-2-enamide (PubChem CID 44533536) has the molecular formula C23H23Cl2N3O2 and a molecular weight of 444.36 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[2,2-dimethyl-3-[(4-oxo-1H-quinolin-2-yl)amino]propyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[2,2-dimethyl-3-[(4-oxo-1H-quinolin-2-yl)amino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 44533536 |
| Molecular Formula | C23H23Cl2N3O2 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[2,2-dimethyl-3-[(4-oxo-1H-quinolin-2-yl)amino]propyl]prop-2-enamide |
| SMILES | CC(C)(CNC(=O)/C=C/c1ccc(Cl)c(Cl)c1)CNc1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C23H23Cl2N3O2/c1-23(2,13-26-21-12-20(29)16-5-3-4-6-19(16)28-21)14-27-22(30)10-8-15-7-9-17(24)18(25)11-15/h3-12H,13-14H2,1-2H3,(H,27,30)(H2,26,28,29)/b10-8+ |
| InChIKey | KOXWWMVHWVDRPV-CSKARUKUSA-N |
| XLogP | 5.10 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|