C32H52ClN3O — CID 44533996
4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]-6-(piperidin-3-ylmethoxy)quinoline;hydrochloride (PubChem CID 44533996) has the molecular formula C32H52ClN3O and a molecular weight of 530.24 g/mol. Its IUPAC name is 4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]-6-(piperidin-3-ylmethoxy)quinoline;hydrochloride.
| Compound Name | 4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]-6-(piperidin-3-ylmethoxy)quinoline;hydrochloride |
|---|---|
| PubChem CID | 44533996 |
| Molecular Formula | C32H52ClN3O |
| Molecular Weight | 530.24 g/mol |
| Exact Mass | 529.38 |
| IUPAC Name | 4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]-6-(piperidin-3-ylmethoxy)quinoline;hydrochloride |
| SMILES | CCCCCCCN1CC[C@@H](CCCc2ccnc3ccc(OCC4CCCNC4)cc23)[C@@H](CC)C1.Cl |
| InChI | InChI=1S/C32H51N3O.ClH/c1-3-5-6-7-8-20-35-21-17-28(27(4-2)24-35)12-9-13-29-16-19-34-32-15-14-30(22-31(29)32)36-25-26-11-10-18-33-23-26;/h14-16,19,22,26-28,33H,3-13,17-18,20-21,23-25H2,1-2H3;1H/t26?,27-,28+;/m0./s1 |
| InChIKey | XRYLAHHWXPDTHD-WBTWIXHZSA-N |
| XLogP | 7.68 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.24 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|