C37H45N5O — CID 44534918
1-[3-(4-methylpiperazin-1-yl)propyl]-3-phenyl-1-[[3-[3-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]urea (PubChem CID 44534918) has the molecular formula C37H45N5O and a molecular weight of 575.80 g/mol. Its IUPAC name is 1-[3-(4-methylpiperazin-1-yl)propyl]-3-phenyl-1-[[3-[3-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-[3-(4-methylpiperazin-1-yl)propyl]-3-phenyl-1-[[3-[3-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 44534918 |
| Molecular Formula | C37H45N5O |
| Molecular Weight | 575.80 g/mol |
| Exact Mass | 575.36 |
| IUPAC Name | 1-[3-(4-methylpiperazin-1-yl)propyl]-3-phenyl-1-[[3-[3-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]urea |
| SMILES | CN1CCN(CCCN(Cc2cccc(-c3cccc(CNCCc4ccccc4)c3)c2)C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C37H45N5O/c1-40-23-25-41(26-24-40)21-10-22-42(37(43)39-36-17-6-3-7-18-36)30-33-14-9-16-35(28-33)34-15-8-13-32(27-34)29-38-20-19-31-11-4-2-5-12-31/h2-9,11-18,27-28,38H,10,19-26,29-30H2,1H3,(H,39,43) |
| InChIKey | FRASXPXZJMKDKT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.80 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|