C22H19ClN2O — CID 44536182
4-(4-chlorophenyl)-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)benzamide (PubChem CID 44536182) has the molecular formula C22H19ClN2O and a molecular weight of 362.86 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)benzamide.
| Compound Name | 4-(4-chlorophenyl)-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 44536182 |
| Molecular Formula | C22H19ClN2O |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)CNCC2)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H19ClN2O/c23-20-8-5-16(6-9-20)15-1-3-18(4-2-15)22(26)25-21-10-7-17-11-12-24-14-19(17)13-21/h1-10,13,24H,11-12,14H2,(H,25,26) |
| InChIKey | ZHTLIYZNDSEXGT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |