C15H15Cl2N3O — CID 75495881
2-chloro-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyridine-3-carboxamide;hydrochloride (PubChem CID 75495881) has the molecular formula C15H15Cl2N3O and a molecular weight of 324.21 g/mol. Its IUPAC name is 2-chloro-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyridine-3-carboxamide;hydrochloride.
| Compound Name | 2-chloro-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 75495881 |
| Molecular Formula | C15H15Cl2N3O |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-chloro-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyridine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc2c(c1)CNCC2)c1cccnc1Cl |
| InChI | InChI=1S/C15H14ClN3O.ClH/c16-14-13(2-1-6-18-14)15(20)19-12-4-3-10-5-7-17-9-11(10)8-12;/h1-4,6,8,17H,5,7,9H2,(H,19,20);1H |
| InChIKey | OQCIDPULNBVZSJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|