C24H32Cl2N2O — CID 44536677
7-[3-[4-(4-chlorophenyl)piperidin-1-yl]propoxy]-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride (PubChem CID 44536677) has the molecular formula C24H32Cl2N2O and a molecular weight of 435.44 g/mol. Its IUPAC name is 7-[3-[4-(4-chlorophenyl)piperidin-1-yl]propoxy]-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride.
| Compound Name | 7-[3-[4-(4-chlorophenyl)piperidin-1-yl]propoxy]-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride |
|---|---|
| PubChem CID | 44536677 |
| Molecular Formula | C24H32Cl2N2O |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 7-[3-[4-(4-chlorophenyl)piperidin-1-yl]propoxy]-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride |
| SMILES | Cl.Clc1ccc(C2CCN(CCCOc3ccc4c(c3)CCNCC4)CC2)cc1 |
| InChI | InChI=1S/C24H31ClN2O.ClH/c25-23-5-2-19(3-6-23)21-10-15-27(16-11-21)14-1-17-28-24-7-4-20-8-12-26-13-9-22(20)18-24;/h2-7,18,21,26H,1,8-17H2;1H |
| InChIKey | GYNJEDUVXRASKG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|