C22H19N5O4 — CID 44538922
1-(4-cyanophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea (PubChem CID 44538922) has the molecular formula C22H19N5O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 44538922 |
| Molecular Formula | C22H19N5O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]urea |
| SMILES | N#Cc1ccc(NC(=O)NCc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C22H19N5O4/c23-10-13-1-4-16(5-2-13)25-22(31)24-11-14-3-6-17-15(9-14)12-27(21(17)30)18-7-8-19(28)26-20(18)29/h1-6,9,18H,7-8,11-12H2,(H2,24,25,31)(H,26,28,29) |
| InChIKey | BHBMWIGRSYWSDH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|