C21H17Cl3N4O4 — CID 44539130
1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(2,4,6-trichlorophenyl)urea (PubChem CID 44539130) has the molecular formula C21H17Cl3N4O4 and a molecular weight of 495.75 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(2,4,6-trichlorophenyl)urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(2,4,6-trichlorophenyl)urea |
|---|---|
| PubChem CID | 44539130 |
| Molecular Formula | C21H17Cl3N4O4 |
| Molecular Weight | 495.75 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-(2,4,6-trichlorophenyl)urea |
| SMILES | O=C1CCC(N2Cc3cc(CNC(=O)Nc4c(Cl)cc(Cl)cc4Cl)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H17Cl3N4O4/c22-12-6-14(23)18(15(24)7-12)27-21(32)25-8-10-1-2-13-11(5-10)9-28(20(13)31)16-3-4-17(29)26-19(16)30/h1-2,5-7,16H,3-4,8-9H2,(H2,25,27,32)(H,26,29,30) |
| InChIKey | PLNAZLLLWBOGRU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.75 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|