C22H31N7O3 — CID 44540264
4-(5-hydroxypentylamino)-2-[4-[3-(methylcarbamoyl)pyrrolidin-1-yl]anilino]pyrimidine-5-carboxamide (PubChem CID 44540264) has the molecular formula C22H31N7O3 and a molecular weight of 441.54 g/mol. Its IUPAC name is 4-(5-hydroxypentylamino)-2-[4-[3-(methylcarbamoyl)pyrrolidin-1-yl]anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(5-hydroxypentylamino)-2-[4-[3-(methylcarbamoyl)pyrrolidin-1-yl]anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 44540264 |
| Molecular Formula | C22H31N7O3 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 4-(5-hydroxypentylamino)-2-[4-[3-(methylcarbamoyl)pyrrolidin-1-yl]anilino]pyrimidine-5-carboxamide |
| SMILES | CNC(=O)C1CCN(c2ccc(Nc3ncc(C(N)=O)c(NCCCCCO)n3)cc2)C1 |
| InChI | InChI=1S/C22H31N7O3/c1-24-21(32)15-9-11-29(14-15)17-7-5-16(6-8-17)27-22-26-13-18(19(23)31)20(28-22)25-10-3-2-4-12-30/h5-8,13,15,30H,2-4,9-12,14H2,1H3,(H2,23,31)(H,24,32)(H2,25,26,27,28) |
| InChIKey | GGKNKXMJLGQBJG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 145.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|