C20H24FN3O5 — CID 44540288
tert-butyl N-[(4-fluorophenyl)methyl]-N-[[5-hydroxy-6-(hydroxycarbamoyl)-4-methyl-3-pyridinyl]methyl]carbamate (PubChem CID 44540288) has the molecular formula C20H24FN3O5 and a molecular weight of 405.43 g/mol. Its IUPAC name is tert-butyl N-[(4-fluorophenyl)methyl]-N-[[5-hydroxy-6-(hydroxycarbamoyl)-4-methyl-3-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[(4-fluorophenyl)methyl]-N-[[5-hydroxy-6-(hydroxycarbamoyl)-4-methyl-3-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 44540288 |
| Molecular Formula | C20H24FN3O5 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | tert-butyl N-[(4-fluorophenyl)methyl]-N-[[5-hydroxy-6-(hydroxycarbamoyl)-4-methyl-3-pyridinyl]methyl]carbamate |
| SMILES | Cc1c(CN(Cc2ccc(F)cc2)C(=O)OC(C)(C)C)cnc(C(=O)NO)c1O |
| InChI | InChI=1S/C20H24FN3O5/c1-12-14(9-22-16(17(12)25)18(26)23-28)11-24(19(27)29-20(2,3)4)10-13-5-7-15(21)8-6-13/h5-9,25,28H,10-11H2,1-4H3,(H,23,26) |
| InChIKey | LKRWOEFFDOHCBS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|