C21H28N2O4 — CID 44543381
3-benzyl-1-(2,2-diethoxyethyl)-1-phenylmethoxyurea (PubChem CID 44543381) has the molecular formula C21H28N2O4 and a molecular weight of 372.46 g/mol. Its IUPAC name is 3-benzyl-1-(2,2-diethoxyethyl)-1-phenylmethoxyurea.
| Compound Name | 3-benzyl-1-(2,2-diethoxyethyl)-1-phenylmethoxyurea |
|---|---|
| PubChem CID | 44543381 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 3-benzyl-1-(2,2-diethoxyethyl)-1-phenylmethoxyurea |
| SMILES | CCOC(CN(OCc1ccccc1)C(=O)NCc1ccccc1)OCC |
| InChI | InChI=1S/C21H28N2O4/c1-3-25-20(26-4-2)16-23(27-17-19-13-9-6-10-14-19)21(24)22-15-18-11-7-5-8-12-18/h5-14,20H,3-4,15-17H2,1-2H3,(H,22,24) |
| InChIKey | DYBCVEJYZSMBKO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|