C26H37NO7 — CID 44543735
4-[(2S,5S)-2-hydroxy-5-[(2R,3Z,5R,6R,8E,12E)-6-hydroxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-4-oxohexyl]piperidine-2,6-dione (PubChem CID 44543735) has the molecular formula C26H37NO7 and a molecular weight of 475.58 g/mol. Its IUPAC name is 4-[(2S,5S)-2-hydroxy-5-[(2R,3Z,5R,6R,8E,12E)-6-hydroxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-4-oxohexyl]piperidine-2,6-dione.
| Compound Name | 4-[(2S,5S)-2-hydroxy-5-[(2R,3Z,5R,6R,8E,12E)-6-hydroxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-4-oxohexyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 44543735 |
| Molecular Formula | C26H37NO7 |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 4-[(2S,5S)-2-hydroxy-5-[(2R,3Z,5R,6R,8E,12E)-6-hydroxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-4-oxohexyl]piperidine-2,6-dione |
| SMILES | C/C1=C/[C@@H](C)[C@H](O)C/C=C/CC/C=C/C(=O)O[C@@H]1[C@H](C)C(=O)C[C@@H](O)CC1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C26H37NO7/c1-16-11-17(2)26(34-25(33)10-8-6-4-5-7-9-21(16)29)18(3)22(30)15-20(28)12-19-13-23(31)27-24(32)14-19/h5,7-8,10-11,16,18-21,26,28-29H,4,6,9,12-15H2,1-3H3,(H,27,31,32)/b7-5+,10-8+,17-11-/t16-,18-,20+,21-,26+/m1/s1 |
| InChIKey | WMXAKTGNPKDKIO-FWQQOSAQSA-N |
| XLogP | 2.54 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|