C14H10ClF3N2O2 — CID 44544031
N-[3-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]phenyl]acetamide (PubChem CID 44544031) has the molecular formula C14H10ClF3N2O2 and a molecular weight of 330.69 g/mol. Its IUPAC name is N-[3-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]phenyl]acetamide.
| Compound Name | N-[3-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]phenyl]acetamide |
|---|---|
| PubChem CID | 44544031 |
| Molecular Formula | C14H10ClF3N2O2 |
| Molecular Weight | 330.69 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | N-[3-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-n2cc(C(F)(F)F)cc(Cl)c2=O)c1 |
| InChI | InChI=1S/C14H10ClF3N2O2/c1-8(21)19-10-3-2-4-11(6-10)20-7-9(14(16,17)18)5-12(15)13(20)22/h2-7H,1H3,(H,19,21) |
| InChIKey | YIRFGYAEGMMCMV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.69 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |