C12H17BrO4 — CID 44549439
[(1S,2R)-2-acetyloxy-3-(2-bromoethyl)cyclohex-3-en-1-yl] acetate (PubChem CID 44549439) has the molecular formula C12H17BrO4 and a molecular weight of 305.17 g/mol. Its IUPAC name is [(1S,2R)-2-acetyloxy-3-(2-bromoethyl)cyclohex-3-en-1-yl] acetate.
| Compound Name | [(1S,2R)-2-acetyloxy-3-(2-bromoethyl)cyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 44549439 |
| Molecular Formula | C12H17BrO4 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | [(1S,2R)-2-acetyloxy-3-(2-bromoethyl)cyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC=C(CCBr)[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H17BrO4/c1-8(14)16-11-5-3-4-10(6-7-13)12(11)17-9(2)15/h4,11-12H,3,5-7H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | AYQBNTTZMOPFKD-NWDGAFQWSA-N |
| XLogP | 2.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|