C17H26N6O6 — CID 44549911
N-[(2S)-1-[2-(2-amino-2-oxoethyl)-2-[(E)-4-(cyclopropylamino)-4-oxobut-2-enoyl]hydrazinyl]-1-oxopropan-2-yl]morpholine-4-carboxamide (PubChem CID 44549911) has the molecular formula C17H26N6O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is N-[(2S)-1-[2-(2-amino-2-oxoethyl)-2-[(E)-4-(cyclopropylamino)-4-oxobut-2-enoyl]hydrazinyl]-1-oxopropan-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[(2S)-1-[2-(2-amino-2-oxoethyl)-2-[(E)-4-(cyclopropylamino)-4-oxobut-2-enoyl]hydrazinyl]-1-oxopropan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 44549911 |
| Molecular Formula | C17H26N6O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N-[(2S)-1-[2-(2-amino-2-oxoethyl)-2-[(E)-4-(cyclopropylamino)-4-oxobut-2-enoyl]hydrazinyl]-1-oxopropan-2-yl]morpholine-4-carboxamide |
| SMILES | C[C@H](NC(=O)N1CCOCC1)C(=O)NN(CC(N)=O)C(=O)/C=C/C(=O)NC1CC1 |
| InChI | InChI=1S/C17H26N6O6/c1-11(19-17(28)22-6-8-29-9-7-22)16(27)21-23(10-13(18)24)15(26)5-4-14(25)20-12-2-3-12/h4-5,11-12H,2-3,6-10H2,1H3,(H2,18,24)(H,19,28)(H,20,25)(H,21,27)/b5-4+/t11-/m0/s1 |
| InChIKey | FOZOIIZFXQOIQD-ZWNMCFTASA-N |
| XLogP | -2.40 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|