C19H31N7O7 — CID 44549137
ethyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2S)-2-(piperazine-1-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate (PubChem CID 44549137) has the molecular formula C19H31N7O7 and a molecular weight of 469.50 g/mol. Its IUPAC name is ethyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2S)-2-(piperazine-1-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2S)-2-(piperazine-1-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 44549137 |
| Molecular Formula | C19H31N7O7 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | ethyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2S)-2-(piperazine-1-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)N(CC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)N1CCNCC1 |
| InChI | InChI=1S/C19H31N7O7/c1-4-33-16(29)6-5-15(28)26(11-14(20)27)24-18(31)13(3)22-17(30)12(2)23-19(32)25-9-7-21-8-10-25/h5-6,12-13,21H,4,7-11H2,1-3H3,(H2,20,27)(H,22,30)(H,23,32)(H,24,31)/b6-5+/t12-,13-/m0/s1 |
| InChIKey | XGZGRAYDKODNRE-AAAGKOELSA-N |
| XLogP | -3.04 |
| TPSA | 192.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|