C20H32N6O7 — CID 44550032
ethyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2S)-2-(piperidine-1-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate (PubChem CID 44550032) has the molecular formula C20H32N6O7 and a molecular weight of 468.51 g/mol. Its IUPAC name is ethyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2S)-2-(piperidine-1-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2S)-2-(piperidine-1-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 44550032 |
| Molecular Formula | C20H32N6O7 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | ethyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2S)-2-(piperidine-1-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)N(CC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H32N6O7/c1-4-33-17(29)9-8-16(28)26(12-15(21)27)24-19(31)14(3)22-18(30)13(2)23-20(32)25-10-6-5-7-11-25/h8-9,13-14H,4-7,10-12H2,1-3H3,(H2,21,27)(H,22,30)(H,23,32)(H,24,31)/b9-8+/t13-,14-/m0/s1 |
| InChIKey | DARAZXMCYTYZQB-CFYKVZDHSA-N |
| XLogP | -1.46 |
| TPSA | 180.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|