C19H30N6O8 — CID 45483357
ethyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2R)-2-(morpholine-4-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate (PubChem CID 45483357) has the molecular formula C19H30N6O8 and a molecular weight of 470.48 g/mol. Its IUPAC name is ethyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2R)-2-(morpholine-4-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2R)-2-(morpholine-4-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 45483357 |
| Molecular Formula | C19H30N6O8 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | ethyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2R)-2-(morpholine-4-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)N(CC(N)=O)NC(=O)[C@H](C)NC(=O)[C@@H](C)NC(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H30N6O8/c1-4-33-16(28)6-5-15(27)25(11-14(20)26)23-18(30)13(3)21-17(29)12(2)22-19(31)24-7-9-32-10-8-24/h5-6,12-13H,4,7-11H2,1-3H3,(H2,20,26)(H,21,29)(H,22,31)(H,23,30)/b6-5+/t12-,13+/m1/s1 |
| InChIKey | QCLLJZFTGASVFY-PBJSTTKNSA-N |
| XLogP | -2.61 |
| TPSA | 189.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|