C13H13F3O5S — CID 44550532
ethyl (E)-4,4,4-trifluoro-3-(4-methylphenyl)sulfonyloxybut-2-enoate (PubChem CID 44550532) has the molecular formula C13H13F3O5S and a molecular weight of 338.30 g/mol. Its IUPAC name is ethyl (E)-4,4,4-trifluoro-3-(4-methylphenyl)sulfonyloxybut-2-enoate.
| Compound Name | ethyl (E)-4,4,4-trifluoro-3-(4-methylphenyl)sulfonyloxybut-2-enoate |
|---|---|
| PubChem CID | 44550532 |
| Molecular Formula | C13H13F3O5S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | ethyl (E)-4,4,4-trifluoro-3-(4-methylphenyl)sulfonyloxybut-2-enoate |
| SMILES | CCOC(=O)/C=C(/OS(=O)(=O)c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3O5S/c1-3-20-12(17)8-11(13(14,15)16)21-22(18,19)10-6-4-9(2)5-7-10/h4-8H,3H2,1-2H3/b11-8+ |
| InChIKey | URFABOFJLMIUJY-DHZHZOJOSA-N |
| XLogP | 2.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|