C21H25NO6 — CID 44551535
triethyl 6-methyl-1-phenyl-4H-pyridine-2,3,5-tricarboxylate (PubChem CID 44551535) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is triethyl 6-methyl-1-phenyl-4H-pyridine-2,3,5-tricarboxylate.
| Compound Name | triethyl 6-methyl-1-phenyl-4H-pyridine-2,3,5-tricarboxylate |
|---|---|
| PubChem CID | 44551535 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | triethyl 6-methyl-1-phenyl-4H-pyridine-2,3,5-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccccc2)C(C(=O)OCC)=C(C(=O)OCC)C1 |
| InChI | InChI=1S/C21H25NO6/c1-5-26-19(23)16-13-17(20(24)27-6-2)18(21(25)28-7-3)22(14(16)4)15-11-9-8-10-12-15/h8-12H,5-7,13H2,1-4H3 |
| InChIKey | HYTGEGOYEBVRBP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|