C30H26N2O4 — CID 44552274
2-amino-1-(4-methoxyphenyl)-6,7-bis(phenylmethoxy)isoquinolin-3-one (PubChem CID 44552274) has the molecular formula C30H26N2O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-amino-1-(4-methoxyphenyl)-6,7-bis(phenylmethoxy)isoquinolin-3-one.
| Compound Name | 2-amino-1-(4-methoxyphenyl)-6,7-bis(phenylmethoxy)isoquinolin-3-one |
|---|---|
| PubChem CID | 44552274 |
| Molecular Formula | C30H26N2O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-amino-1-(4-methoxyphenyl)-6,7-bis(phenylmethoxy)isoquinolin-3-one |
| SMILES | COc1ccc(-c2c3cc(OCc4ccccc4)c(OCc4ccccc4)cc3cc(=O)n2N)cc1 |
| InChI | InChI=1S/C30H26N2O4/c1-34-25-14-12-23(13-15-25)30-26-18-28(36-20-22-10-6-3-7-11-22)27(16-24(26)17-29(33)32(30)31)35-19-21-8-4-2-5-9-21/h2-18H,19-20,31H2,1H3 |
| InChIKey | VYDRKZGLXMYJQK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |