C19H19N5O3S — CID 44553354
ethyl 5-[5-methyl-2-(prop-2-enylcarbamoylamino)-[1,3]thiazolo[5,4-b]pyridin-6-yl]pyridine-3-carboxylate (PubChem CID 44553354) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is ethyl 5-[5-methyl-2-(prop-2-enylcarbamoylamino)-[1,3]thiazolo[5,4-b]pyridin-6-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[5-methyl-2-(prop-2-enylcarbamoylamino)-[1,3]thiazolo[5,4-b]pyridin-6-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 44553354 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | ethyl 5-[5-methyl-2-(prop-2-enylcarbamoylamino)-[1,3]thiazolo[5,4-b]pyridin-6-yl]pyridine-3-carboxylate |
| SMILES | C=CCNC(=O)Nc1nc2cc(-c3cncc(C(=O)OCC)c3)c(C)nc2s1 |
| InChI | InChI=1S/C19H19N5O3S/c1-4-6-21-18(26)24-19-23-15-8-14(11(3)22-16(15)28-19)12-7-13(10-20-9-12)17(25)27-5-2/h4,7-10H,1,5-6H2,2-3H3,(H2,21,23,24,26) |
| InChIKey | GZMLWTJVCKWLMY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|