C16H16N6O2S — CID 44553353
1-[6-(2-methoxypyrimidin-5-yl)-5-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-prop-2-enylurea (PubChem CID 44553353) has the molecular formula C16H16N6O2S and a molecular weight of 356.41 g/mol. Its IUPAC name is 1-[6-(2-methoxypyrimidin-5-yl)-5-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-prop-2-enylurea.
| Compound Name | 1-[6-(2-methoxypyrimidin-5-yl)-5-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 44553353 |
| Molecular Formula | C16H16N6O2S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-[6-(2-methoxypyrimidin-5-yl)-5-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1nc2cc(-c3cnc(OC)nc3)c(C)nc2s1 |
| InChI | InChI=1S/C16H16N6O2S/c1-4-5-17-14(23)22-16-21-12-6-11(9(2)20-13(12)25-16)10-7-18-15(24-3)19-8-10/h4,6-8H,1,5H2,2-3H3,(H2,17,21,22,23) |
| InChIKey | GEJIZNBRSSMRMD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|