About N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide
N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide (PubChem CID 44555950) has the molecular formula C8H11ClN4O3S
and a molecular weight of 278.72 g/mol. Its IUPAC name is N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide.
Molecular Properties
| Compound Name | N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide |
| PubChem CID | 44555950 |
| Molecular Formula | C8H11ClN4O3S |
| Molecular Weight | 278.72 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide |
| SMILES | CC(NS(C)(=O)=N[N+](=O)[O-])c1ccc(Cl)nc1 |
| InChI | InChI=1S/C8H11ClN4O3S/c1-6(7-3-4-8(9)10-5-7)11-17(2,16)12-13(14)15/h3-6H,1-2H3,(H,11,12,16) |
| InChIKey | UZDFBNFRHZPSJA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.72 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide?
The IUPAC name of N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide (CID 44555950) is N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide.
What is the SMILES notation for N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide?
The canonical SMILES for N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide is CC(NS(C)(=O)=N[N+](=O)[O-])c1ccc(Cl)nc1.
What is the InChIKey of N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide?
The InChIKey is UZDFBNFRHZPSJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN4O3S/c1-6(7-3-4-8(9)10-5-7)11-17(2,16)12-13(14)15/h3-6H,1-2H3,(H,11,12,16).
What are the key properties of N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide?
N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide has a molecular weight of 278.72 g/mol, XLogP of 1.59, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(6-chloro-3-pyridinyl)ethylamino]-methyl-oxo-λ6-sulfanylidene]nitramide is sourced from PubChem (CID 44555950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).