C4H5Br3S — CID 44558400
2,3,4-tribromothiolane (PubChem CID 44558400) has the molecular formula C4H5Br3S and a molecular weight of 324.86 g/mol. Its IUPAC name is 2,3,4-tribromothiolane.
| Compound Name | 2,3,4-tribromothiolane |
|---|---|
| PubChem CID | 44558400 |
| Molecular Formula | C4H5Br3S |
| Molecular Weight | 324.86 g/mol |
| Exact Mass | 321.77 |
| IUPAC Name | 2,3,4-tribromothiolane |
| SMILES | BrC1CSC(Br)C1Br |
| InChI | InChI=1S/C4H5Br3S/c5-2-1-8-4(7)3(2)6/h2-4H,1H2 |
| InChIKey | RFBZNKUBRWTNGO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.86 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|