C17H26O3 — CID 44559943
2-[(2E,6Z,9Z,12Z)-pentadeca-2,6,9,12-tetraenoxy]acetic acid (PubChem CID 44559943) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-[(2E,6Z,9Z,12Z)-pentadeca-2,6,9,12-tetraenoxy]acetic acid.
| Compound Name | 2-[(2E,6Z,9Z,12Z)-pentadeca-2,6,9,12-tetraenoxy]acetic acid |
|---|---|
| PubChem CID | 44559943 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2-[(2E,6Z,9Z,12Z)-pentadeca-2,6,9,12-tetraenoxy]acetic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CC/C=C/COCC(=O)O |
| InChI | InChI=1S/C17H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20-16-17(18)19/h3-4,6-7,9-10,13-14H,2,5,8,11-12,15-16H2,1H3,(H,18,19)/b4-3-,7-6-,10-9-,14-13+ |
| InChIKey | BJYYIZGGYGZMCV-TWMAVKMASA-N |
| XLogP | 4.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|