C19H28O5 — CID 44561069
(4R,5R,6R,7R,10R)-10-[(E,3R,5R)-3,5-dimethylhept-1-enyl]-4,6,7-trihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one (PubChem CID 44561069) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (4R,5R,6R,7R,10R)-10-[(E,3R,5R)-3,5-dimethylhept-1-enyl]-4,6,7-trihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one.
| Compound Name | (4R,5R,6R,7R,10R)-10-[(E,3R,5R)-3,5-dimethylhept-1-enyl]-4,6,7-trihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one |
|---|---|
| PubChem CID | 44561069 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (4R,5R,6R,7R,10R)-10-[(E,3R,5R)-3,5-dimethylhept-1-enyl]-4,6,7-trihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one |
| SMILES | C=C1OC(=O)[C@@]2([C@H](/C=C/[C@H](C)C[C@H](C)CC)C=C[C@@H](O)[C@@H]2O)[C@H]1O |
| InChI | InChI=1S/C19H28O5/c1-5-11(2)10-12(3)6-7-14-8-9-15(20)17(22)19(14)16(21)13(4)24-18(19)23/h6-9,11-12,14-17,20-22H,4-5,10H2,1-3H3/b7-6+/t11-,12+,14-,15-,16+,17+,19+/m1/s1 |
| InChIKey | FCZKZHGNJNETSF-YTZRTTPESA-N |
| XLogP | 1.94 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|