C16H23NO2 — CID 44561546
(2E,6E,8E)-2,6-dimethyl-10-oxo-10-pyrrolidin-1-yldeca-2,6,8-trienal (PubChem CID 44561546) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is (2E,6E,8E)-2,6-dimethyl-10-oxo-10-pyrrolidin-1-yldeca-2,6,8-trienal.
| Compound Name | (2E,6E,8E)-2,6-dimethyl-10-oxo-10-pyrrolidin-1-yldeca-2,6,8-trienal |
|---|---|
| PubChem CID | 44561546 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (2E,6E,8E)-2,6-dimethyl-10-oxo-10-pyrrolidin-1-yldeca-2,6,8-trienal |
| SMILES | C/C(C=O)=C\CC/C(C)=C/C=C/C(=O)N1CCCC1 |
| InChI | InChI=1S/C16H23NO2/c1-14(7-5-9-15(2)13-18)8-6-10-16(19)17-11-3-4-12-17/h6,8-10,13H,3-5,7,11-12H2,1-2H3/b10-6+,14-8+,15-9+ |
| InChIKey | VOMDUWUNYFLEIJ-GRVFCJIBSA-N |
| XLogP | 3.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|