C23H20N2O2S — CID 44562271
8-(5-phenyl-1,3-thiazol-2-yl)-2-piperidin-1-ylchromen-4-one (PubChem CID 44562271) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is 8-(5-phenyl-1,3-thiazol-2-yl)-2-piperidin-1-ylchromen-4-one.
| Compound Name | 8-(5-phenyl-1,3-thiazol-2-yl)-2-piperidin-1-ylchromen-4-one |
|---|---|
| PubChem CID | 44562271 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 8-(5-phenyl-1,3-thiazol-2-yl)-2-piperidin-1-ylchromen-4-one |
| SMILES | O=c1cc(N2CCCCC2)oc2c(-c3ncc(-c4ccccc4)s3)cccc12 |
| InChI | InChI=1S/C23H20N2O2S/c26-19-14-21(25-12-5-2-6-13-25)27-22-17(19)10-7-11-18(22)23-24-15-20(28-23)16-8-3-1-4-9-16/h1,3-4,7-11,14-15H,2,5-6,12-13H2 |
| InChIKey | IIFMQVJPEDMMNF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |