C32H37N5O4 — CID 44562964
(5R)-13-cyclopentyl-5-ethyl-N-[2-(4-methylpiperazin-1-yl)ethyl]-7,9-dioxo-6-oxa-10,20-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2,4(8),12,14,16,18-heptaene-5-carboxamide (PubChem CID 44562964) has the molecular formula C32H37N5O4 and a molecular weight of 555.68 g/mol. Its IUPAC name is (5R)-13-cyclopentyl-5-ethyl-N-[2-(4-methylpiperazin-1-yl)ethyl]-7,9-dioxo-6-oxa-10,20-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2,4(8),12,14,16,18-heptaene-5-carboxamide.
| Compound Name | (5R)-13-cyclopentyl-5-ethyl-N-[2-(4-methylpiperazin-1-yl)ethyl]-7,9-dioxo-6-oxa-10,20-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2,4(8),12,14,16,18-heptaene-5-carboxamide |
|---|---|
| PubChem CID | 44562964 |
| Molecular Formula | C32H37N5O4 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | (5R)-13-cyclopentyl-5-ethyl-N-[2-(4-methylpiperazin-1-yl)ethyl]-7,9-dioxo-6-oxa-10,20-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2,4(8),12,14,16,18-heptaene-5-carboxamide |
| SMILES | CC[C@@]1(C(=O)NCCN2CCN(C)CC2)OC(=O)c2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2C1CCCC1 |
| InChI | InChI=1S/C32H37N5O4/c1-3-32(31(40)33-12-13-36-16-14-35(2)15-17-36)23-18-25-28-22(19-37(25)29(38)27(23)30(39)41-32)26(20-8-4-5-9-20)21-10-6-7-11-24(21)34-28/h6-7,10-11,18,20H,3-5,8-9,12-17,19H2,1-2H3,(H,33,40)/t32-/m1/s1 |
| InChIKey | GNHUIEBFHDCVEV-JGCGQSQUSA-N |
| XLogP | 3.22 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|