C23H26Cl4N2O2 — CID 44563395
3-(3,4-dichlorophenyl)-N-[5-[3-(3,4-dichlorophenyl)propanoylamino]pentyl]propanamide (PubChem CID 44563395) has the molecular formula C23H26Cl4N2O2 and a molecular weight of 504.29 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[5-[3-(3,4-dichlorophenyl)propanoylamino]pentyl]propanamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[5-[3-(3,4-dichlorophenyl)propanoylamino]pentyl]propanamide |
|---|---|
| PubChem CID | 44563395 |
| Molecular Formula | C23H26Cl4N2O2 |
| Molecular Weight | 504.29 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[5-[3-(3,4-dichlorophenyl)propanoylamino]pentyl]propanamide |
| SMILES | O=C(CCc1ccc(Cl)c(Cl)c1)NCCCCCNC(=O)CCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H26Cl4N2O2/c24-18-8-4-16(14-20(18)26)6-10-22(30)28-12-2-1-3-13-29-23(31)11-7-17-5-9-19(25)21(27)15-17/h4-5,8-9,14-15H,1-3,6-7,10-13H2,(H,28,30)(H,29,31) |
| InChIKey | CDLJSJMMZWSMLK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.29 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|