C15H15N5OS2 — CID 44564989
2-amino-5-(1-methylimidazol-2-yl)sulfanyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 44564989) has the molecular formula C15H15N5OS2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-amino-5-(1-methylimidazol-2-yl)sulfanyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-amino-5-(1-methylimidazol-2-yl)sulfanyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 44564989 |
| Molecular Formula | C15H15N5OS2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-amino-5-(1-methylimidazol-2-yl)sulfanyl-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1csc(NC(=O)c2cc(Sc3nccn3C)ccc2N)n1 |
| InChI | InChI=1S/C15H15N5OS2/c1-9-8-22-14(18-9)19-13(21)11-7-10(3-4-12(11)16)23-15-17-5-6-20(15)2/h3-8H,16H2,1-2H3,(H,18,19,21) |
| InChIKey | GIQZMGJQUQFLRK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|