C23H22ClN3O3 — CID 44565545
Imidazole-dioxolane, 29 (PubChem CID 44565545) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is 4-[[(2R,4R)-2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]benzonitrile.
| Compound Name | Imidazole-dioxolane, 29 |
|---|---|
| PubChem CID | 44565545 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 4-[[(2R,4R)-2-[2-(4-chlorophenyl)ethyl]-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]benzonitrile |
| SMILES | C1[C@H](O[C@](O1)(CCC2=CC=C(C=C2)Cl)CN3C=CN=C3)COC4=CC=C(C=C4)C#N |
| InChI | InChI=1S/C23H22ClN3O3/c24-20-5-1-18(2-6-20)9-10-23(16-27-12-11-26-17-27)29-15-22(30-23)14-28-21-7-3-19(13-25)4-8-21/h1-8,11-12,17,22H,9-10,14-16H2/t22-,23-/m1/s1 |
| InChIKey | RGJNTVPHUAKXGQ-DHIUTWEWSA-N |
| XLogP | 3.80 |
| TPSA | 69.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | 583 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |