C22H23ClN2O3 — CID 44565516
Imidazole-dioxolane, 23 (PubChem CID 44565516) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.90 g/mol. Its IUPAC name is 1-[[(2R,4R)-2-[2-(4-chlorophenyl)ethyl]-4-(phenoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole.
| Compound Name | Imidazole-dioxolane, 23 |
|---|---|
| PubChem CID | 44565516 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.90 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-[[(2R,4R)-2-[2-(4-chlorophenyl)ethyl]-4-(phenoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole |
| SMILES | C1[C@H](O[C@](O1)(CCC2=CC=C(C=C2)Cl)CN3C=CN=C3)COC4=CC=CC=C4 |
| InChI | InChI=1S/C22H23ClN2O3/c23-19-8-6-18(7-9-19)10-11-22(16-25-13-12-24-17-25)27-15-21(28-22)14-26-20-4-2-1-3-5-20/h1-9,12-13,17,21H,10-11,14-16H2/t21-,22-/m1/s1 |
| InChIKey | XYYMNOMXLKGBLH-FGZHOGPDSA-N |
| XLogP | 4.10 |
| TPSA | 45.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | 469 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.90 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |