C22H22ClFN2O3 — CID 44565520
Imidazole-dioxolane, 25 (PubChem CID 44565520) has the molecular formula C22H22ClFN2O3 and a molecular weight of 416.90 g/mol. Its IUPAC name is 1-[[(2R,4R)-2-[2-(4-chlorophenyl)ethyl]-4-[(4-fluorophenoxy)methyl]-1,3-dioxolan-2-yl]methyl]imidazole.
| Compound Name | Imidazole-dioxolane, 25 |
|---|---|
| PubChem CID | 44565520 |
| Molecular Formula | C22H22ClFN2O3 |
| Molecular Weight | 416.90 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-[[(2R,4R)-2-[2-(4-chlorophenyl)ethyl]-4-[(4-fluorophenoxy)methyl]-1,3-dioxolan-2-yl]methyl]imidazole |
| SMILES | C1[C@H](O[C@](O1)(CCC2=CC=C(C=C2)Cl)CN3C=CN=C3)COC4=CC=C(C=C4)F |
| InChI | InChI=1S/C22H22ClFN2O3/c23-18-3-1-17(2-4-18)9-10-22(15-26-12-11-25-16-26)28-14-21(29-22)13-27-20-7-5-19(24)6-8-20/h1-8,11-12,16,21H,9-10,13-15H2/t21-,22-/m1/s1 |
| InChIKey | NFGDAKKMMGHJNO-FGZHOGPDSA-N |
| XLogP | 4.20 |
| TPSA | 45.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | 500 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.90 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |