C26H31F4N3O4 — CID 44566060
2-(4-fluorophenyl)-N-[3-methyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]-4-morpholin-4-yl-4-oxobutanamide (PubChem CID 44566060) has the molecular formula C26H31F4N3O4 and a molecular weight of 525.54 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[3-methyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]-4-morpholin-4-yl-4-oxobutanamide.
| Compound Name | 2-(4-fluorophenyl)-N-[3-methyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]-4-morpholin-4-yl-4-oxobutanamide |
|---|---|
| PubChem CID | 44566060 |
| Molecular Formula | C26H31F4N3O4 |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[3-methyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]-4-morpholin-4-yl-4-oxobutanamide |
| SMILES | CC(C)C(CNc1ccc(OC(F)(F)F)cc1)NC(=O)C(CC(=O)N1CCOCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H31F4N3O4/c1-17(2)23(16-31-20-7-9-21(10-8-20)37-26(28,29)30)32-25(35)22(18-3-5-19(27)6-4-18)15-24(34)33-11-13-36-14-12-33/h3-10,17,22-23,31H,11-16H2,1-2H3,(H,32,35) |
| InChIKey | KJAHPFVPXUFAGF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|