C39H44O7 — CID 44566208
[(2R,6R,7R,10S,12R,13R,14R)-4,4,7,17,18,18-hexamethyl-11-methylidene-16-oxo-10-[(E)-3-phenylprop-2-enoyl]oxy-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-en-13-yl] benzoate (PubChem CID 44566208) has the molecular formula C39H44O7 and a molecular weight of 624.77 g/mol. Its IUPAC name is [(2R,6R,7R,10S,12R,13R,14R)-4,4,7,17,18,18-hexamethyl-11-methylidene-16-oxo-10-[(E)-3-phenylprop-2-enoyl]oxy-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-en-13-yl] benzoate.
| Compound Name | [(2R,6R,7R,10S,12R,13R,14R)-4,4,7,17,18,18-hexamethyl-11-methylidene-16-oxo-10-[(E)-3-phenylprop-2-enoyl]oxy-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-en-13-yl] benzoate |
|---|---|
| PubChem CID | 44566208 |
| Molecular Formula | C39H44O7 |
| Molecular Weight | 624.77 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | [(2R,6R,7R,10S,12R,13R,14R)-4,4,7,17,18,18-hexamethyl-11-methylidene-16-oxo-10-[(E)-3-phenylprop-2-enoyl]oxy-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-en-13-yl] benzoate |
| SMILES | C=C1[C@@H](OC(=O)/C=C/c2ccccc2)CC[C@@]2(C)[C@H]3OC(C)(C)O[C@@H]3C3=C(C)C(=O)C[C@@H]([C@@H](OC(=O)c4ccccc4)[C@H]12)C3(C)C |
| InChI | InChI=1S/C39H44O7/c1-23-28(40)22-27-33(44-36(42)26-16-12-9-13-17-26)32-24(2)29(43-30(41)19-18-25-14-10-8-11-15-25)20-21-39(32,7)35-34(31(23)37(27,3)4)45-38(5,6)46-35/h8-19,27,29,32-35H,2,20-22H2,1,3-7H3/b19-18+/t27-,29-,32-,33+,34+,35-,39+/m0/s1 |
| InChIKey | DEDUNAWXFUOPCH-QBYLWLORSA-N |
| XLogP | 7.28 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.77 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|